GIF89a;
Server IP : 172.26.0.195 / Your IP : 3.145.92.98 Web Server : Apache System : Linux 43-205-77-33.cprapid.com 3.10.0-1160.119.1.el7.tuxcare.els2.x86_64 #1 SMP Mon Jul 15 12:09:18 UTC 2024 x86_64 User : jnclnmuac ( 1026) PHP Version : 8.0.30 Disable Function : NONE MySQL : OFF | cURL : ON | WGET : ON | Perl : ON | Python : ON Directory (0755) : /home/jnclnmuac/public_html/web/../alumni/../css/../cas/../grievance/assets/js/ |
[ Home ] | [ C0mmand ] | [ Upload File ] |
---|
/* jquery.nicescroll -- version 3.7.6 -- copyright 2017-07-19 InuYaksa*2017 -- licensed under the MIT -- -- https://nicescroll.areaaperta.com/ -- https://github.com/inuyaksa/jquery.nicescroll -- */ /* jshint expr: true */ (function (factory) { if (typeof define === 'function' && define.amd) { // AMD. Register as anonymous module. define(['jquery'], factory); } else if (typeof exports === 'object') { // Node/CommonJS. module.exports = factory(require('jquery')); } else { // Browser globals. factory(jQuery); } }(function (jQuery) { "use strict"; // globals var domfocus = false, mousefocus = false, tabindexcounter = 0, ascrailcounter = 2000, globalmaxzindex = 0; var $ = jQuery, // sandbox _doc = document, _win = window, $window = $(_win); var delegatevents = []; // http://stackoverflow.com/questions/2161159/get-script-path function getScriptPath() { var scripts = _doc.currentScript || (function () { var s = _doc.getElementsByTagName('script'); return (s.length) ? s[s.length - 1] : false; })(); var path = scripts ? scripts.src.split('?')[0] : ''; return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : ''; } // based on code by Paul Irish https://www.paulirish.com/2011/requestanimationframe-for-smart-animating/ var setAnimationFrame = _win.requestAnimationFrame || _win.webkitRequestAnimationFrame || _win.mozRequestAnimationFrame || false; var clearAnimationFrame = _win.cancelAnimationFrame || _win.webkitCancelAnimationFrame || _win.mozCancelAnimationFrame || false; if (!setAnimationFrame) { var anilasttime = 0; setAnimationFrame = function (callback, element) { var currTime = new Date().getTime(); var timeToCall = Math.max(0, 16 - (currTime - anilasttime)); var id = _win.setTimeout(function () { callback(currTime + timeToCall); }, timeToCall); anilasttime = currTime + timeToCall; return id; }; clearAnimationFrame = function (id) { _win.clearTimeout(id); }; } else { if (!_win.cancelAnimationFrame) clearAnimationFrame = function (id) { }; } var ClsMutationObserver = _win.MutationObserver || _win.WebKitMutationObserver || false; var now = Date.now || function () { return new Date().getTime(); }; var _globaloptions = { zindex: "auto", cursoropacitymin: 0, cursoropacitymax: 1, cursorcolor: "#424242", cursorwidth: "6px", cursorborder: "1px solid #fff", cursorborderradius: "5px", scrollspeed: 40, mousescrollstep: 9 * 3, touchbehavior: false, // deprecated emulatetouch: false, // replacing touchbehavior hwacceleration: true, usetransition: true, boxzoom: false, dblclickzoom: true, gesturezoom: true, grabcursorenabled: true, autohidemode: true, background: "", iframeautoresize: true, cursorminheight: 32, preservenativescrolling: true, railoffset: false, railhoffset: false, bouncescroll: true, spacebarenabled: true, railpadding: { top: 0, right: 0, left: 0, bottom: 0 }, disableoutline: true, horizrailenabled: true, railalign: "right", railvalign: "bottom", enabletranslate3d: true, enablemousewheel: true, enablekeyboard: true, smoothscroll: true, sensitiverail: true, enablemouselockapi: true, // cursormaxheight:false, cursorfixedheight: false, directionlockdeadzone: 6, hidecursordelay: 400, nativeparentscrolling: true, enablescrollonselection: true, overflowx: true, overflowy: true, cursordragspeed: 0.3, rtlmode: "auto", cursordragontouch: false, oneaxismousemode: "auto", scriptpath: getScriptPath(), preventmultitouchscrolling: true, disablemutationobserver: false, enableobserver: true, scrollbarid: false, scrollCLass: false }; var browserdetected = false; var getBrowserDetection = function () { if (browserdetected) return browserdetected; var _el = _doc.createElement('DIV'), _style = _el.style, _agent = navigator.userAgent, _platform = navigator.platform, d = {}; d.haspointerlock = "pointerLockElement" in _doc || "webkitPointerLockElement" in _doc || "mozPointerLockElement" in _doc; d.isopera = ("opera" in _win); // 12- d.isopera12 = (d.isopera && ("getUserMedia" in navigator)); d.isoperamini = (Object.prototype.toString.call(_win.operamini) === "[object OperaMini]"); d.isie = (("all" in _doc) && ("attachEvent" in _el) && !d.isopera); //IE10- d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older d.isie7 = d.isie && !d.isieold && (!("documentMode" in _doc) || (_doc.documentMode === 7)); d.isie8 = d.isie && ("documentMode" in _doc) && (_doc.documentMode === 8); d.isie9 = d.isie && ("performance" in _win) && (_doc.documentMode === 9); d.isie10 = d.isie && ("performance" in _win) && (_doc.documentMode === 10); d.isie11 = ("msRequestFullscreen" in _el) && (_doc.documentMode >= 11); // IE11+ d.ismsedge = ("msCredentials" in _win); // MS Edge 14+ d.ismozilla = ("MozAppearance" in _style); d.iswebkit = !d.ismsedge && ("WebkitAppearance" in _style); d.ischrome = d.iswebkit && ("chrome" in _win); d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation d.ischrome22 = (!d.ischrome38) && (d.ischrome && d.haspointerlock); d.ischrome26 = (!d.ischrome38) && (d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix) d.cantouch = ("ontouchstart" in _doc.documentElement) || ("ontouchstart" in _win); // with detection for Chrome Touch Emulation d.hasw3ctouch = (_win.PointerEvent || false) && ((navigator.maxTouchPoints > 0) || (navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec d.hasmstouch = (!d.hasw3ctouch) && (_win.MSPointerEvent || false); // IE10 pointer events d.ismac = /^mac$/i.test(_platform); d.isios = d.cantouch && /iphone|ipad|ipod/i.test(_platform); d.isios4 = d.isios && !("seal" in Object); d.isios7 = d.isios && ("webkitHidden" in _doc); //iOS 7+ d.isios8 = d.isios && ("hidden" in _doc); //iOS 8+ d.isios10 = d.isios && _win.Proxy; //iOS 10+ d.isandroid = (/android/i.test(_agent)); d.haseventlistener = ("addEventListener" in _el); d.trstyle = false; d.hastransform = false; d.hastranslate3d = false; d.transitionstyle = false; d.hastransition = false; d.transitionend = false; d.trstyle = "transform"; d.hastransform = ("transform" in _style) || (function () { var check = ['msTransform', 'webkitTransform', 'MozTransform', 'OTransform']; for (var a = 0, c = check.length; a < c; a++) { if (_style[check[a]] !== undefined) { d.trstyle = check[a]; break; } } d.hastransform = (!!d.trstyle); })(); if (d.hastransform) { _style[d.trstyle] = "translate3d(1px,2px,3px)"; d.hastranslate3d = /translate3d/.test(_style[d.trstyle]); } d.transitionstyle = "transition"; d.prefixstyle = ''; d.transitionend = "transitionend"; d.hastransition = ("transition" in _style) || (function () { d.transitionend = false; var check = ['webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition']; var prefix = ['-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-']; var evs = ['webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd']; for (var a = 0, c = check.length; a < c; a++) { if (check[a] in _style) { d.transitionstyle = check[a]; d.prefixstyle = prefix[a]; d.transitionend = evs[a]; break; } } if (d.ischrome26) d.prefixstyle = prefix[1]; // always use prefix d.hastransition = (d.transitionstyle); })(); function detectCursorGrab() { var lst = ['grab', '-webkit-grab', '-moz-grab']; if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug for (var a = 0, l = lst.length; a < l; a++) { var p = lst[a]; _style.cursor = p; if (_style.cursor == p) return p; } return 'url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize'; // thanks to https://cdnjs.com/ for the openhand cursor! } d.cursorgrabvalue = detectCursorGrab(); d.hasmousecapture = ("setCapture" in _el); d.hasMutationObserver = (ClsMutationObserver !== false); _el = null; //memory released browserdetected = d; return d; }; var NiceScrollClass = function (myopt, me) { var self = this; this.version = '3.7.6'; this.name = 'nicescroll'; this.me = me; var $body = $("body"); var opt = this.opt = { doc: $body, win: false }; $.extend(opt, _globaloptions); // clone opts // Options for internal use opt.snapbackspeed = 80; if (myopt || false) { for (var a in opt) { if (myopt[a] !== undefined) opt[a] = myopt[a]; } } if (opt.disablemutationobserver) ClsMutationObserver = false; this.doc = opt.doc; this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : ''; this.ispage = /^BODY|HTML/.test((opt.win) ? opt.win[0].nodeName : this.doc[0].nodeName); this.haswrapper = (opt.win !== false); this.win = opt.win || (this.ispage ? $window : this.doc); this.docscroll = (this.ispage && !this.haswrapper) ? $window : this.win; this.body = $body; this.viewport = false; this.isfixed = false; this.iframe = false; this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME')); this.istextarea = (this.win[0].nodeName == 'TEXTAREA'); this.forcescreen = false; //force to use screen position on events this.canshowonmouseevent = (opt.autohidemode != "scroll"); // Events jump table this.onmousedown = false; this.onmouseup = false; this.onmousemove = false; this.onmousewheel = false; this.onkeypress = false; this.ongesturezoom = false; this.onclick = false; // Nicescroll custom events this.onscrollstart = false; this.onscrollend = false; this.onscrollcancel = false; this.onzoomin = false; this.onzoomout = false; // Let's start! this.view = false; this.page = false; this.scroll = { x: 0, y: 0 }; this.scrollratio = { x: 0, y: 0 }; this.cursorheight = 20; this.scrollvaluemax = 0; // http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical // http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode if (opt.rtlmode == "auto") { var target = this.win[0] == _win ? this.body : this.win; var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode"); if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode === "") { this.isrtlmode = (target.css("direction") == "rtl"); this.isvertical = false; } else { this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb"); this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl"); } } else { this.isrtlmode = (opt.rtlmode === true); this.isvertical = false; } // this.checkrtlmode = false; this.scrollrunning = false; this.scrollmom = false; this.observer = false; // observer div changes this.observerremover = false; // observer on parent for remove detection this.observerbody = false; // observer on body for position change if (opt.scrollbarid !== false) { this.id = opt.scrollbarid; } else { do { this.id = "ascrail" + (ascrailcounter++); } while (_doc.getElementById(this.id)); } this.rail = false; this.cursor = false; this.cursorfreezed = false; this.selectiondrag = false; this.zoom = false; this.zoomactive = false; this.hasfocus = false; this.hasmousefocus = false; //this.visibility = true; this.railslocked = false; // locked by resize this.locked = false; // prevent lost of locked status sets by user this.hidden = false; // rails always hidden this.cursoractive = true; // user can interact with cursors this.wheelprevented = false; //prevent mousewheel event this.overflowx = opt.overflowx; this.overflowy = opt.overflowy; this.nativescrollingarea = false; this.checkarea = 0; this.events = []; // event list for unbind this.saved = {}; // style saved this.delaylist = {}; this.synclist = {}; this.lastdeltax = 0; this.lastdeltay = 0; this.detected = getBrowserDetection(); var cap = $.extend({}, this.detected); this.canhwscroll = (cap.hastransform && opt.hwacceleration); this.ishwscroll = (this.canhwscroll && self.haswrapper); if (!this.isrtlmode) { this.hasreversehr = false; } else if (this.isvertical) { // RTL mode with reverse horizontal axis this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11); } else { this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11)); } this.istouchcapable = false; // desktop devices with touch screen support //## Check WebKit-based desktop with touch support //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support) if (!cap.cantouch && (cap.hasw3ctouch || cap.hasmstouch)) { // desktop device with multiple input this.istouchcapable = true; } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) { this.istouchcapable = true; } //## disable MouseLock API on user request if (!opt.enablemouselockapi) { cap.hasmousecapture = false; cap.haspointerlock = false; } this.debounced = function (name, fn, tm) { if (!self) return; var dd = self.delaylist[name] || false; if (!dd) { self.delaylist[name] = { h: setAnimationFrame(function () { self.delaylist[name].fn.call(self); self.delaylist[name] = false; }, tm) }; fn.call(self); } self.delaylist[name].fn = fn; }; this.synched = function (name, fn) { if (self.synclist[name]) self.synclist[name] = fn; else { self.synclist[name] = fn; setAnimationFrame(function () { if (!self) return; self.synclist[name] && self.synclist[name].call(self); self.synclist[name] = null; }); } }; this.unsynched = function (name) { if (self.synclist[name]) self.synclist[name] = false; }; this.css = function (el, pars) { // save & set for (var n in pars) { self.saved.css.push([el, n, el.css(n)]); el.css(n, pars[n]); } }; this.scrollTop = function (val) { return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val); }; this.scrollLeft = function (val) { return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val); }; // derived by by Dan Pupius www.pupius.net var BezierClass = function (st, ed, spd, p1, p2, p3, p4) { this.st = st; this.ed = ed; this.spd = spd; this.p1 = p1 || 0; this.p2 = p2 || 1; this.p3 = p3 || 0; this.p4 = p4 || 1; this.ts = now(); this.df = ed - st; }; BezierClass.prototype = { B2: function (t) { return 3 * (1 - t) * (1 - t) * t; }, B3: function (t) { return 3 * (1 - t) * t * t; }, B4: function (t) { return t * t * t; }, getPos: function () { return (now() - this.ts) / this.spd; }, getNow: function () { var pc = (now() - this.ts) / this.spd; var bz = this.B2(pc) + this.B3(pc) + this.B4(pc); return (pc >= 1) ? this.ed : this.st + (this.df * bz) | 0; }, update: function (ed, spd) { this.st = this.getNow(); this.ed = ed; this.spd = spd; this.ts = now(); this.df = this.ed - this.st; return this; } }; //derived from http://stackoverflow.com/questions/11236090/ function getMatrixValues() { var tr = self.doc.css(cap.trstyle); if (tr && (tr.substr(0, 6) == "matrix")) { return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/); } return false; } if (this.ishwscroll) { // hw accelerated scroll this.doc.translate = { x: 0, y: 0, tx: "0px", ty: "0px" }; //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/ if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/ this.getScrollTop = function (last) { if (!last) { var mtx = getMatrixValues(); if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10 if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow(); } return self.doc.translate.y; }; this.getScrollLeft = function (last) { if (!last) { var mtx = getMatrixValues(); if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10 if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow(); } return self.doc.translate.x; }; this.notifyScrollEvent = function (el) { var e = _doc.createEvent("UIEvents"); e.initUIEvent("scroll", false, false, _win, 1); e.niceevent = true; el.dispatchEvent(e); }; var cxscrollleft = (this.isrtlmode) ? 1 : -1; if (cap.hastranslate3d && opt.enabletranslate3d) { this.setScrollTop = function (val, silent) { self.doc.translate.y = val; self.doc.translate.ty = (val * -1) + "px"; self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)"); if (!silent) self.notifyScrollEvent(self.win[0]); }; this.setScrollLeft = function (val, silent) { self.doc.translate.x = val; self.doc.translate.tx = (val * cxscrollleft) + "px"; self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)"); if (!silent) self.notifyScrollEvent(self.win[0]); }; } else { this.setScrollTop = function (val, silent) { self.doc.translate.y = val; self.doc.translate.ty = (val * -1) + "px"; self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")"); if (!silent) self.notifyScrollEvent(self.win[0]); }; this.setScrollLeft = function (val, silent) { self.doc.translate.x = val; self.doc.translate.tx = (val * cxscrollleft) + "px"; self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")"); if (!silent) self.notifyScrollEvent(self.win[0]); }; } } else { // native scroll this.getScrollTop = function () { return self.docscroll.scrollTop(); }; this.setScrollTop = function (val) { self.docscroll.scrollTop(val); }; this.getScrollLeft = function () { var val; if (!self.hasreversehr) { val = self.docscroll.scrollLeft(); } else if (self.detected.ismozilla) { val = self.page.maxw - Math.abs(self.docscroll.scrollLeft()); } else { val = self.page.maxw - self.docscroll.scrollLeft(); } return val; }; this.setScrollLeft = function (val) { return setTimeout(function () { if (!self) return; if (self.hasreversehr) { if (self.detected.ismozilla) { val = -(self.page.maxw - val); } else { val = self.page.maxw - val; } } return self.docscroll.scrollLeft(val); }, 1); }; } this.getTarget = function (e) { if (!e) return false; if (e.target) return e.target; if (e.srcElement) return e.srcElement; return false; }; this.hasParent = function (e, id) { if (!e) return false; var el = e.target || e.srcElement || e || false; while (el && el.id != id) { el = el.parentNode || false; } return (el !== false); }; function getZIndex() { var dom = self.win; if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available while (dom.length > 0) { if (dom[0].nodeType == 9) return false; var zi = dom.css('zIndex'); if (!isNaN(zi) && zi !== 0) return parseInt(zi); dom = dom.parent(); } return false; } //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie var _convertBorderWidth = { "thin": 1, "medium": 3, "thick": 5 }; function getWidthToPixel(dom, prop, chkheight) { var wd = dom.css(prop); var px = parseFloat(wd); if (isNaN(px)) { px = _convertBorderWidth[wd] || 0; var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS if (self.isie8 && px) px += 1; return (brd) ? px : 0; } return px; } this.getDocumentScrollOffset = function () { return { top: _win.pageYOffset || _doc.documentElement.scrollTop, left: _win.pageXOffset || _doc.documentElement.scrollLeft }; }; this.getOffset = function () { if (self.isfixed) { var ofs = self.win.offset(); // fix Chrome auto issue (when right/bottom props only) var scrl = self.getDocumentScrollOffset(); ofs.top -= scrl.top; ofs.left -= scrl.left; return ofs; } var ww = self.win.offset(); if (!self.viewport) return ww; var vp = self.viewport.offset(); return { top: ww.top - vp.top, left: ww.left - vp.left }; }; this.updateScrollBar = function (len) { var pos, off; if (self.ishwscroll) { self.rail.css({ height: self.win.innerHeight() - (opt.railpadding.top + opt.railpadding.bottom) }); if (self.railh) self.railh.css({ width: self.win.innerWidth() - (opt.railpadding.left + opt.railpadding.right) }); } else { var wpos = self.getOffset(); pos = { top: wpos.top, left: wpos.left - (opt.railpadding.left + opt.railpadding.right) }; pos.top += getWidthToPixel(self.win, 'border-top-width', true); pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width'); off = opt.railoffset; if (off) { if (off.top) pos.top += off.top; if (off.left) pos.left += off.left; } if (!self.railslocked) self.rail.css({ top: pos.top, left: pos.left, height: ((len) ? len.h : self.win.innerHeight()) - (opt.railpadding.top + opt.railpadding.bottom) }); if (self.zoom) { self.zoom.css({ top: pos.top + 1, left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4 }); } if (self.railh && !self.railslocked) { pos = { top: wpos.top, left: wpos.left }; off = opt.railhoffset; if (off) { if (off.top) pos.top += off.top; if (off.left) pos.left += off.left; } var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true); var x = pos.left + getWidthToPixel(self.win, 'border-left-width'); self.railh.css({ top: y - (opt.railpadding.top + opt.railpadding.bottom), left: x, width: self.railh.width }); } } }; this.doRailClick = function (e, dbl, hr) { var fn, pg, cur, pos; if (self.railslocked) return; self.cancelEvent(e); if (!("pageY" in e)) { e.pageX = e.clientX + _doc.documentElement.scrollLeft; e.pageY = e.clientY + _doc.documentElement.scrollTop; } if (dbl) { fn = (hr) ? self.doScrollLeft : self.doScrollTop; cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y); self.unsynched("relativexy"); fn(cur|0); } else { fn = (hr) ? self.doScrollLeftBy : self.doScrollBy; cur = (hr) ? self.scroll.x : self.scroll.y; pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top; pg = (hr) ? self.view.w : self.view.h; fn((cur >= pos) ? pg : -pg); } }; self.newscrolly = self.newscrollx = 0; self.hasanimationframe = ("requestAnimationFrame" in _win); self.hascancelanimationframe = ("cancelAnimationFrame" in _win); self.hasborderbox = false; this.init = function () { self.saved.css = []; if (cap.isoperamini) return true; // SORRY, DO NOT WORK! if (cap.isandroid && !("hidden" in _doc)) return true; // Android 3- SORRY, DO NOT WORK! opt.emulatetouch = opt.emulatetouch || opt.touchbehavior; // mantain compatibility with "touchbehavior" self.hasborderbox = _win.getComputedStyle && (_win.getComputedStyle(_doc.body)['box-sizing'] === "border-box"); var _scrollyhidden = { 'overflow-y': 'hidden' }; if (cap.isie11 || cap.isie10) _scrollyhidden['-ms-overflow-style'] = 'none'; // IE 10 & 11 is always a world apart! if (self.ishwscroll) { this.doc.css(cap.transitionstyle, cap.prefixstyle + 'transform 0ms ease-out'); if (cap.transitionend) self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!! } self.zindex = "auto"; if (!self.ispage && opt.zindex == "auto") { self.zindex = getZIndex() || "auto"; } else { self.zindex = opt.zindex; } if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) { globalmaxzindex = self.zindex; } if (self.isie && self.zindex === 0 && opt.zindex == "auto") { // fix IE auto == 0 self.zindex = "auto"; } if (!self.ispage || !cap.isieold) { var cont = self.docscroll; if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc; self.css(cont, _scrollyhidden); if (self.ispage && (cap.isie11 || cap.isie)) { // IE 7-11 self.css($("html"), _scrollyhidden); } if (cap.isios && !self.ispage && !self.haswrapper) self.css($body, { "-webkit-overflow-scrolling": "touch" }); //force hw acceleration var cursor = $(_doc.createElement('div')); cursor.css({ position: "relative", top: 0, "float": "right", width: opt.cursorwidth, height: 0, 'background-color': opt.cursorcolor, border: opt.cursorborder, 'background-clip': 'padding-box', '-webkit-border-radius': opt.cursorborderradius, '-moz-border-radius': opt.cursorborderradius, 'border-radius': opt.cursorborderradius }); cursor.addClass('nicescroll-cursors'); self.cursor = cursor; var rail = $(_doc.createElement('div')); rail.attr('id', self.id); rail.addClass('nicescroll-rails nicescroll-rails-vr'); if (opt.scrollCLass) { rail.addClass(opt.scrollCLass); } var v, a, kp = ["left", "right", "top", "bottom"]; //** for (var n in kp) { a = kp[n]; v = opt.railpadding[a] || 0; v && rail.css("padding-" + a, v + "px"); } rail.append(cursor); rail.width = Math.max(parseFloat(opt.cursorwidth), cursor.outerWidth()); rail.css({ width: rail.width + "px", zIndex: self.zindex, background: opt.background, cursor: "default" }); rail.visibility = true; rail.scrollable = true; rail.align = (opt.railalign == "left") ? 0 : 1; self.rail = rail; self.rail.drag = false; var zoom = false; if (opt.boxzoom && !self.ispage && !cap.isieold) { zoom = _doc.createElement('div'); self.bind(zoom, "click", self.doZoom); self.bind(zoom, "mouseenter", function () { self.zoom.css('opacity', opt.cursoropacitymax); }); self.bind(zoom, "mouseleave", function () { self.zoom.css('opacity', opt.cursoropacitymin); }); self.zoom = $(zoom); self.zoom.css({ cursor: "pointer", zIndex: self.zindex, backgroundImage: 'url(' + opt.scriptpath + 'zoomico.png)', height: 18, width: 18, backgroundPosition: '0 0' }); if (opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom); if (cap.cantouch && opt.gesturezoom) { self.ongesturezoom = function (e) { if (e.scale > 1.5) self.doZoomIn(e); if (e.scale < 0.8) self.doZoomOut(e); return self.cancelEvent(e); }; self.bind(self.win, "gestureend", self.ongesturezoom); } } // init HORIZ self.railh = false; var railh; if (opt.horizrailenabled) { self.css(cont, { overflowX: 'hidden' }); cursor = $(_doc.createElement('div')); cursor.css({ position: "absolute", top: 0, height: opt.cursorwidth, width: 0, backgroundColor: opt.cursorcolor, border: opt.cursorborder, backgroundClip: 'padding-box', '-webkit-border-radius': opt.cursorborderradius, '-moz-border-radius': opt.cursorborderradius, 'border-radius': opt.cursorborderradius }); if (cap.isieold) cursor.css('overflow', 'hidden'); //IE6 horiz scrollbar issue cursor.addClass('nicescroll-cursors'); self.cursorh = cursor; railh = $(_doc.createElement('div')); railh.attr('id', self.id + '-hr'); railh.addClass('nicescroll-rails nicescroll-rails-hr'); if (opt.scrollCLass) { railh.addClass(opt.scrollCLass); } railh.height = Math.max(parseFloat(opt.cursorwidth), cursor.outerHeight()); railh.css({ height: railh.height + "px", 'zIndex': self.zindex, "background": opt.background }); railh.append(cursor); railh.visibility = true; railh.scrollable = true; railh.align = (opt.railvalign == "top") ? 0 : 1; self.railh = railh; self.railh.drag = false; } if (self.ispage) { rail.css({ position: "fixed", top: 0, height: "100%" }); rail.css((rail.align) ? { right: 0 } : { left: 0 }); self.body.append(rail); if (self.railh) { railh.css({ position: "fixed", left: 0, width: "100%" }); railh.css((railh.align) ? { bottom: 0 } : { top: 0 }); self.body.append(railh); } } else { if (self.ishwscroll) { if (self.win.css('position') == 'static') self.css(self.win, { 'position': 'relative' }); var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win; $(bd).scrollTop(0).scrollLeft(0); // fix rail position if content already scrolled if (self.zoom) { self.zoom.css({ position: "absolute", top: 1, right: 0, "margin-right": rail.width + 4 }); bd.append(self.zoom); } rail.css({ position: "absolute", top: 0 }); rail.css((rail.align) ? { right: 0 } : { left: 0 }); bd.append(rail); if (railh) { railh.css({ position: "absolute", left: 0, bottom: 0 }); railh.css((railh.align) ? { bottom: 0 } : { top: 0 }); bd.append(railh); } } else { self.isfixed = (self.win.css("position") == "fixed"); var rlpos = (self.isfixed) ? "fixed" : "absolute"; if (!self.isfixed) self.viewport = self.getViewport(self.win[0]); if (self.viewport) { self.body = self.viewport; if (!(/fixed|absolute/.test(self.viewport.css("position")))) self.css(self.viewport, { "position": "relative" }); } rail.css({ position: rlpos }); if (self.zoom) self.zoom.css({ position: rlpos }); self.updateScrollBar(); self.body.append(rail); if (self.zoom) self.body.append(self.zoom); if (self.railh) { railh.css({ position: rlpos }); self.body.append(railh); } } if (cap.isios) self.css(self.win, { '-webkit-tap-highlight-color': 'rgba(0,0,0,0)', '-webkit-touch-callout': 'none' }); // prevent grey layer on click if (opt.disableoutline) { if (cap.isie) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div if (cap.iswebkit) self.win.css('outline', 'none'); // Webkit outline } } if (opt.autohidemode === false) { self.autohidedom = false; self.rail.css({ opacity: opt.cursoropacitymax }); if (self.railh) self.railh.css({ opacity: opt.cursoropacitymax }); } else if ((opt.autohidemode === true) || (opt.autohidemode === "leave")) { self.autohidedom = $().add(self.rail); if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor); if (self.railh) self.autohidedom = self.autohidedom.add(self.railh); if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh); } else if (opt.autohidemode == "scroll") { self.autohidedom = $().add(self.rail); if (self.railh) self.autohidedom = self.autohidedom.add(self.railh); } else if (opt.autohidemode == "cursor") { self.autohidedom = $().add(self.cursor); if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh); } else if (opt.autohidemode == "hidden") { self.autohidedom = false; self.hide(); self.railslocked = false; } if (cap.cantouch || self.istouchcapable || opt.emulatetouch || cap.hasmstouch) { self.scrollmom = new ScrollMomentumClass2D(self); var delayedclick = null; self.ontouchstart = function (e) { if (self.locked) return false; //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false; if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false; // need test on surface!! self.hasmoving = false; if (self.scrollmom.timer) { self.triggerScrollEnd(); self.scrollmom.stop(); } if (!self.railslocked) { var tg = self.getTarget(e); if (tg) { var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type)); if (skp) return self.stopPropagation(e); } var ismouse = (e.type === "mousedown"); if (!("clientX" in e) && ("changedTouches" in e)) { e.clientX = e.changedTouches[0].clientX; e.clientY = e.changedTouches[0].clientY; } if (self.forcescreen) { var le = e; e = { "original": (e.original) ? e.original : e }; e.clientX = le.screenX; e.clientY = le.screenY; } self.rail.drag = { x: e.clientX, y: e.clientY, sx: self.scroll.x, sy: self.scroll.y, st: self.getScrollTop(), sl: self.getScrollLeft(), pt: 2, dl: false, tg: tg }; if (self.ispage || !opt.directionlockdeadzone) { self.rail.drag.dl = "f"; } else { var view = { w: $window.width(), h: $window.height() }; var page = self.getContentSize(); var maxh = page.h - view.h; var maxw = page.w - view.w; if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false; else if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false; else self.rail.drag.ck = false; } if (opt.emulatetouch && self.isiframe && cap.isie) { var wp = self.win.position(); self.rail.drag.x += wp.left; self.rail.drag.y += wp.top; } self.hasmoving = false; self.lastmouseup = false; self.scrollmom.reset(e.clientX, e.clientY); if (tg&&ismouse) { var ip = /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName); if (!ip) { if (cap.hasmousecapture) tg.setCapture(); if (opt.emulatetouch) { if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event tg._onclick = tg.onclick; tg.onclick = function (e) { if (self.hasmoving) return false; tg._onclick.call(this, e); }; } return self.cancelEvent(e); } return self.stopPropagation(e); } if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) { self.preventclick = { "tg": tg, "click": false }; } } } }; self.ontouchend = function (e) { if (!self.rail.drag) return true; if (self.rail.drag.pt == 2) { //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false; if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false; self.rail.drag = false; var ismouse = (e.type === "mouseup"); if (self.hasmoving) { self.scrollmom.doMomentum(); self.lastmouseup = true; self.hideCursor(); if (cap.hasmousecapture) _doc.releaseCapture(); if (ismouse) return self.cancelEvent(e); } } else if (self.rail.drag.pt == 1) { return self.onmouseup(e); } }; var moveneedoffset = (opt.emulatetouch && self.isiframe && !cap.hasmousecapture); var locktollerance = opt.directionlockdeadzone * 0.3 | 0; self.ontouchmove = function (e, byiframe) { if (!self.rail.drag) return true; if (e.targetTouches && opt.preventmultitouchscrolling) { if (e.targetTouches.length > 1) return true; // multitouch } //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false; if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return true; if (self.rail.drag.pt == 2) { if (("changedTouches" in e)) { e.clientX = e.changedTouches[0].clientX; e.clientY = e.changedTouches[0].clientY; } var ofy, ofx; ofx = ofy = 0; if (moveneedoffset && !byiframe) { var wp = self.win.position(); ofx = -wp.left; ofy = -wp.top; } var fy = e.clientY + ofy; var my = (fy - self.rail.drag.y); var fx = e.clientX + ofx; var mx = (fx - self.rail.drag.x); var ny = self.rail.drag.st - my; if (self.ishwscroll && opt.bouncescroll) { if (ny < 0) { ny = Math.round(ny / 2); } else if (ny > self.page.maxh) { ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2); } } else { if (ny < 0) { ny = 0; fy = 0; } else if (ny > self.page.maxh) { ny = self.page.maxh; fy = 0; } if (fy === 0 && !self.hasmoving) { if (!self.ispage) self.rail.drag = false; return true; } } var nx = self.getScrollLeft(); if (self.railh && self.railh.scrollable) { nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx; if (self.ishwscroll && opt.bouncescroll) { if (nx < 0) { nx = Math.round(nx / 2); } else if (nx > self.page.maxw) { nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2); } } else { if (nx < 0) { nx = 0; fx = 0; } if (nx > self.page.maxw) { nx = self.page.maxw; fx = 0; } } } if (!self.hasmoving) { if (self.rail.drag.y === e.clientY && self.rail.drag.x === e.clientX) return self.cancelEvent(e); // prevent first useless move event var ay = Math.abs(my); var ax = Math.abs(mx); var dz = opt.directionlockdeadzone; if (!self.rail.drag.ck) { if (ay > dz && ax > dz) self.rail.drag.dl = "f"; else if (ay > dz) self.rail.drag.dl = (ax > locktollerance) ? "f" : "v"; else if (ax > dz) self.rail.drag.dl = (ay > locktollerance) ? "f" : "h"; } else if (self.rail.drag.ck == "v") { if (ax > dz && ay <= locktollerance) { self.rail.drag = false; } else if (ay > dz) self.rail.drag.dl = "v"; } else if (self.rail.drag.ck == "h") { if (ay > dz && ax <= locktollerance) { self.rail.drag = false; } else if (ax > dz) self.rail.drag.dl = "h"; } if (!self.rail.drag.dl) return self.cancelEvent(e); self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0); self.hasmoving = true; } if (self.preventclick && !self.preventclick.click) { self.preventclick.click = self.preventclick.tg.onclick || false; self.preventclick.tg.onclick = self.onpreventclick; } if (self.rail.drag.dl) { if (self.rail.drag.dl == "v") nx = self.rail.drag.sl; else if (self.rail.drag.dl == "h") ny = self.rail.drag.st; } self.synched("touchmove", function () { if (self.rail.drag && (self.rail.drag.pt == 2)) { if (self.prepareTransition) self.resetTransition(); if (self.rail.scrollable) self.setScrollTop(ny); self.scrollmom.update(fx, fy); if (self.railh && self.railh.scrollable) { self.setScrollLeft(nx); self.showCursor(ny, nx); } else { self.showCursor(ny); } if (cap.isie10) _doc.selection.clear(); } }); return self.cancelEvent(e); } else if (self.rail.drag.pt == 1) { // drag on cursor return self.onmousemove(e); } }; self.ontouchstartCursor = function (e, hronly) { if (self.rail.drag && self.rail.drag.pt != 3) return; if (self.locked) return self.cancelEvent(e); self.cancelScroll(); self.rail.drag = { x: e.touches[0].clientX, y: e.touches[0].clientY, sx: self.scroll.x, sy: self.scroll.y, pt: 3, hr: (!!hronly) }; var tg = self.getTarget(e); if (!self.ispage && cap.hasmousecapture) tg.setCapture(); if (self.isiframe && !cap.hasmousecapture) { self.saved.csspointerevents = self.doc.css("pointer-events"); self.css(self.doc, { "pointer-events": "none" }); } return self.cancelEvent(e); }; self.ontouchendCursor = function (e) { if (self.rail.drag) { if (cap.hasmousecapture) _doc.releaseCapture(); if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents); if (self.rail.drag.pt != 3) return; self.rail.drag = false; return self.cancelEvent(e); } }; self.ontouchmoveCursor = function (e) { if (self.rail.drag) { if (self.rail.drag.pt != 3) return; self.cursorfreezed = true; if (self.rail.drag.hr) { self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x); if (self.scroll.x < 0) self.scroll.x = 0; var mw = self.scrollvaluemaxw; if (self.scroll.x > mw) self.scroll.x = mw; } else { self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y); if (self.scroll.y < 0) self.scroll.y = 0; var my = self.scrollvaluemax; if (self.scroll.y > my) self.scroll.y = my; } self.synched('touchmove', function () { if (self.rail.drag && (self.rail.drag.pt == 3)) { self.showCursor(); if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), opt.cursordragspeed); else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), opt.cursordragspeed); } }); return self.cancelEvent(e); } }; } self.onmousedown = function (e, hronly) { if (self.rail.drag && self.rail.drag.pt != 1) return; if (self.railslocked) return self.cancelEvent(e); self.cancelScroll(); self.rail.drag = { x: e.clientX, y: e.clientY, sx: self.scroll.x, sy: self.scroll.y, pt: 1, hr: hronly || false }; var tg = self.getTarget(e); if (cap.hasmousecapture) tg.setCapture(); if (self.isiframe && !cap.hasmousecapture) { self.saved.csspointerevents = self.doc.css("pointer-events"); self.css(self.doc, { "pointer-events": "none" }); } self.hasmoving = false; return self.cancelEvent(e); }; self.onmouseup = function (e) { if (self.rail.drag) { if (self.rail.drag.pt != 1) return true; if (cap.hasmousecapture) _doc.releaseCapture(); if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents); self.rail.drag = false; self.cursorfreezed = false; if (self.hasmoving) self.triggerScrollEnd(); return self.cancelEvent(e); } }; self.onmousemove = function (e) { if (self.rail.drag) { if (self.rail.drag.pt !== 1) return; if (cap.ischrome && e.which === 0) return self.onmouseup(e); self.cursorfreezed = true; if (!self.hasmoving) self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0); self.hasmoving = true; if (self.rail.drag.hr) { self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x); if (self.scroll.x < 0) self.scroll.x = 0; var mw = self.scrollvaluemaxw; if (self.scroll.x > mw) self.scroll.x = mw; } else { self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y); if (self.scroll.y < 0) self.scroll.y = 0; var my = self.scrollvaluemax; if (self.scroll.y > my) self.scroll.y = my; } self.synched('mousemove', function () { if (self.cursorfreezed) { self.showCursor(); if (self.rail.drag.hr) { self.scrollLeft(Math.round(self.scroll.x * self.scrollratio.x)); } else { self.scrollTop(Math.round(self.scroll.y * self.scrollratio.y)); } } }); return self.cancelEvent(e); } else { self.checkarea = 0; } }; if (cap.cantouch || opt.emulatetouch) { self.onpreventclick = function (e) { if (self.preventclick) { self.preventclick.tg.onclick = self.preventclick.click; self.preventclick = false; return self.cancelEvent(e); } }; self.onclick = (cap.isios) ? false : function (e) { // it needs to check IE11 ??? if (self.lastmouseup) { self.lastmouseup = false; return self.cancelEvent(e); } else { return true; } }; if (opt.grabcursorenabled && cap.cursorgrabvalue) { self.css((self.ispage) ? self.doc : self.win, { 'cursor': cap.cursorgrabvalue }); self.css(self.rail, { 'cursor': cap.cursorgrabvalue }); } } else { var checkSelectionScroll = function (e) { if (!self.selectiondrag) return; if (e) { var ww = self.win.outerHeight(); var df = (e.pageY - self.selectiondrag.top); if (df > 0 && df < ww) df = 0; if (df >= ww) df -= ww; self.selectiondrag.df = df; } if (self.selectiondrag.df === 0) return; var rt = -(self.selectiondrag.df*2/6)|0; self.doScrollBy(rt); self.debounced("doselectionscroll", function () { checkSelectionScroll(); }, 50); }; if ("getSelection" in _doc) { // A grade - Major browsers self.hasTextSelected = function () { return (_doc.getSelection().rangeCount > 0); }; } else if ("selection" in _doc) { //IE9- self.hasTextSelected = function () { return (_doc.selection.type != "None"); }; } else { self.hasTextSelected = function () { // no support return false; }; } self.onselectionstart = function (e) { // More testing - severe chrome issues /* if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling self.win.css({'overflow':'auto'}); setTimeout(function(){ self.win.css({'overflow':'hidden'}); },10); return true; } */ if (self.ispage) return; self.selectiondrag = self.win.offset(); }; self.onselectionend = function (e) { self.selectiondrag = false; }; self.onselectiondrag = function (e) { if (!self.selectiondrag) return; if (self.hasTextSelected()) self.debounced("selectionscroll", function () { checkSelectionScroll(e); }, 250); }; } if (cap.hasw3ctouch) { //IE11+ self.css((self.ispage) ? $("html") : self.win, { 'touch-action': 'none' }); self.css(self.rail, { 'touch-action': 'none' }); self.css(self.cursor, { 'touch-action': 'none' }); self.bind(self.win, "pointerdown", self.ontouchstart); self.bind(_doc, "pointerup", self.ontouchend); self.delegate(_doc, "pointermove", self.ontouchmove); } else if (cap.hasmstouch) { //IE10 self.css((self.ispage) ? $("html") : self.win, { '-ms-touch-action': 'none' }); self.css(self.rail, { '-ms-touch-action': 'none' }); self.css(self.cursor, { '-ms-touch-action': 'none' }); self.bind(self.win, "MSPointerDown", self.ontouchstart); self.bind(_doc, "MSPointerUp", self.ontouchend); self.delegate(_doc, "MSPointerMove", self.ontouchmove); self.bind(self.cursor, "MSGestureHold", function (e) { e.preventDefault(); }); self.bind(self.cursor, "contextmenu", function (e) { e.preventDefault(); }); } else if (cap.cantouch) { // smartphones/touch devices self.bind(self.win, "touchstart", self.ontouchstart, false, true); self.bind(_doc, "touchend", self.ontouchend, false, true); self.bind(_doc, "touchcancel", self.ontouchend, false, true); self.delegate(_doc, "touchmove", self.ontouchmove, false, true); } if (opt.emulatetouch) { self.bind(self.win, "mousedown", self.ontouchstart, false, true); self.bind(_doc, "mouseup", self.ontouchend, false, true); self.bind(_doc, "mousemove", self.ontouchmove, false, true); } if (opt.cursordragontouch || (!cap.cantouch && !opt.emulatetouch)) { self.rail.css({ cursor: "default" }); self.railh && self.railh.css({ cursor: "default" }); self.jqbind(self.rail, "mouseenter", function () { if (!self.ispage && !self.win.is(":visible")) return false; if (self.canshowonmouseevent) self.showCursor(); self.rail.active = true; }); self.jqbind(self.rail, "mouseleave", function () { self.rail.active = false; if (!self.rail.drag) self.hideCursor(); }); if (opt.sensitiverail) { self.bind(self.rail, "click", function (e) { self.doRailClick(e, false, false); }); self.bind(self.rail, "dblclick", function (e) { self.doRailClick(e, true, false); }); self.bind(self.cursor, "click", function (e) { self.cancelEvent(e); }); self.bind(self.cursor, "dblclick", function (e) { self.cancelEvent(e); }); } if (self.railh) { self.jqbind(self.railh, "mouseenter", function () { if (!self.ispage && !self.win.is(":visible")) return false; if (self.canshowonmouseevent) self.showCursor(); self.rail.active = true; }); self.jqbind(self.railh, "mouseleave", function () { self.rail.active = false; if (!self.rail.drag) self.hideCursor(); }); if (opt.sensitiverail) { self.bind(self.railh, "click", function (e) { self.doRailClick(e, false, true); }); self.bind(self.railh, "dblclick", function (e) { self.doRailClick(e, true, true); }); self.bind(self.cursorh, "click", function (e) { self.cancelEvent(e); }); self.bind(self.cursorh, "dblclick", function (e) { self.cancelEvent(e); }); } } } if (opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) { self.bind(self.cursor, "touchstart", self.ontouchstartCursor); self.bind(self.cursor, "touchmove", self.ontouchmoveCursor); self.bind(self.cursor, "touchend", self.ontouchendCursor); self.cursorh && self.bind(self.cursorh, "touchstart", function (e) { self.ontouchstartCursor(e, true); }); self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor); self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor); } // if (!cap.cantouch && !opt.emulatetouch) { if (!opt.emulatetouch && !cap.isandroid && !cap.isios) { self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.onmouseup); self.bind(_doc, "mousemove", self.onmousemove); if (self.onclick) self.bind(_doc, "click", self.onclick); self.bind(self.cursor, "mousedown", self.onmousedown); self.bind(self.cursor, "mouseup", self.onmouseup); if (self.railh) { self.bind(self.cursorh, "mousedown", function (e) { self.onmousedown(e, true); }); self.bind(self.cursorh, "mouseup", self.onmouseup); } if (!self.ispage && opt.enablescrollonselection) { self.bind(self.win[0], "mousedown", self.onselectionstart); self.bind(_doc, "mouseup", self.onselectionend); self.bind(self.cursor, "mouseup", self.onselectionend); if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend); self.bind(_doc, "mousemove", self.onselectiondrag); } if (self.zoom) { self.jqbind(self.zoom, "mouseenter", function () { if (self.canshowonmouseevent) self.showCursor(); self.rail.active = true; }); self.jqbind(self.zoom, "mouseleave", function () { self.rail.active = false; if (!self.rail.drag) self.hideCursor(); }); } } else { self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.ontouchend); if (self.onclick) self.bind(_doc, "click", self.onclick); if (opt.cursordragontouch) { self.bind(self.cursor, "mousedown", self.onmousedown); self.bind(self.cursor, "mouseup", self.onmouseup); self.cursorh && self.bind(self.cursorh, "mousedown", function (e) { self.onmousedown(e, true); }); self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup); } else { self.bind(self.rail, "mousedown", function (e) { e.preventDefault(); }); // prevent text selection self.railh && self.bind(self.railh, "mousedown", function (e) { e.preventDefault(); }); } } if (opt.enablemousewheel) { if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? _doc : self.win, self.onmousewheel); self.mousewheel(self.rail, self.onmousewheel); if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr); } if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) { if (!self.win.attr("tabindex")) self.win.attr({ "tabindex": ++tabindexcounter }); self.bind(self.win, "focus", function (e) { // better using native events domfocus = (self.getTarget(e)).id || self.getTarget(e) || false; self.hasfocus = true; if (self.canshowonmouseevent) self.noticeCursor(); }); self.bind(self.win, "blur", function (e) { // * domfocus = false; self.hasfocus = false; }); self.bind(self.win, "mouseenter", function (e) { // * mousefocus = (self.getTarget(e)).id || self.getTarget(e) || false; self.hasmousefocus = true; if (self.canshowonmouseevent) self.noticeCursor(); }); self.bind(self.win, "mouseleave", function (e) { // * mousefocus = false; self.hasmousefocus = false; if (!self.rail.drag) self.hideCursor(); }); } //Thanks to http://www.quirksmode.org !! self.onkeypress = function (e) { if (self.railslocked && self.page.maxh === 0) return true; e = e || _win.event; var tg = self.getTarget(e); if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) { var tp = tg.getAttribute('type') || tg.type || false; if ((!tp) || !(/submit|button|cancel/i.tp)) return true; } if ($(tg).attr('contenteditable')) return true; if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) { var key = e.keyCode; if (self.railslocked && key != 27) return self.cancelEvent(e); var ctrl = e.ctrlKey || false; var shift = e.shiftKey || false; var ret = false; switch (key) { case 38: case 63233: //safari self.doScrollBy(24 * 3); ret = true; break; case 40: case 63235: //safari self.doScrollBy(-24 * 3); ret = true; break; case 37: case 63232: //safari if (self.railh) { (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24 * 3); ret = true; } break; case 39: case 63234: //safari if (self.railh) { (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24 * 3); ret = true; } break; case 33: case 63276: // safari self.doScrollBy(self.view.h); ret = true; break; case 34: case 63277: // safari self.doScrollBy(-self.view.h); ret = true; break; case 36: case 63273: // safari (self.railh && ctrl) ? self.doScrollPos(0, 0) : self.doScrollTo(0); ret = true; break; case 35: case 63275: // safari (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh) : self.doScrollTo(self.page.maxh); ret = true; break; case 32: if (opt.spacebarenabled) { (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h); ret = true; } break; case 27: // ESC if (self.zoomactive) { self.doZoom(); ret = true; } break; } if (ret) return self.cancelEvent(e); } }; if (opt.enablekeyboard) self.bind(_doc, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress); self.bind(_doc, "keydown", function (e) { var ctrl = e.ctrlKey || false; if (ctrl) self.wheelprevented = true; }); self.bind(_doc, "keyup", function (e) { var ctrl = e.ctrlKey || false; if (!ctrl) self.wheelprevented = false; }); self.bind(_win, "blur", function (e) { self.wheelprevented = false; }); self.bind(_win, 'resize', self.onscreenresize); self.bind(_win, 'orientationchange', self.onscreenresize); self.bind(_win, "load", self.lazyResize); if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26 var tmp = self.win.attr("style"); var ww = parseFloat(self.win.css("width")) + 1; self.win.css('width', ww); self.synched("chromefix", function () { self.win.attr("style", tmp); }); } // Trying a cross-browser implementation - good luck! self.onAttributeChange = function (e) { self.lazyResize(self.isieold ? 250 : 30); }; if (opt.enableobserver) { if ((!self.isie11) && (ClsMutationObserver !== false)) { // IE11 crashes #568 self.observerbody = new ClsMutationObserver(function (mutations) { mutations.forEach(function (mut) { if (mut.type == "attributes") { return ($body.hasClass("modal-open") && $body.hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0], self.doc[0])) ? self.hide() : self.show(); // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal } }); if (self.me.clientWidth != self.page.width || self.me.clientHeight != self.page.height) return self.lazyResize(30); }); self.observerbody.observe(_doc.body, { childList: true, subtree: true, characterData: false, attributes: true, attributeFilter: ['class'] }); } if (!self.ispage && !self.haswrapper) { var _dom = self.win[0]; // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content if (ClsMutationObserver !== false) { self.observer = new ClsMutationObserver(function (mutations) { mutations.forEach(self.onAttributeChange); }); self.observer.observe(_dom, { childList: true, characterData: false, attributes: true, subtree: false }); self.observerremover = new ClsMutationObserver(function (mutations) { mutations.forEach(function (mo) { if (mo.removedNodes.length > 0) { for (var dd in mo.removedNodes) { if (!!self && (mo.removedNodes[dd] === _dom)) return self.remove(); } } }); }); self.observerremover.observe(_dom.parentNode, { childList: true, characterData: false, attributes: false, subtree: false }); } else { self.bind(_dom, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange); if (cap.isie9) _dom.attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug self.bind(_dom, "DOMNodeRemoved", function (e) { if (e.target === _dom) self.remove(); }); } } } // if (!self.ispage && opt.boxzoom) self.bind(_win, "resize", self.resizeZoom); if (self.istextarea) { self.bind(self.win, "keydown", self.lazyResize); self.bind(self.win, "mouseup", self.lazyResize); } self.lazyResize(30); } if (this.doc[0].nodeName == 'IFRAME') { var oniframeload = function () { self.iframexd = false; var doc; try { doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow._doc; var a = doc.domain; } catch (e) { self.iframexd = true; doc = false; } if (self.iframexd) { if ("console" in _win) console.log('NiceScroll error: policy restriced iframe'); return true; //cross-domain - I can't manage this } self.forcescreen = true; if (self.isiframe) { self.iframe = { "doc": $(doc), "html": self.doc.contents().find('html')[0], "body": self.doc.contents().find('body')[0] }; self.getContentSize = function () { return { w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth), h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight) }; }; self.docscroll = $(self.iframe.body); } if (!cap.isios && opt.iframeautoresize && !self.isiframe) { self.win.scrollTop(0); // reset position self.doc.height(""); //reset height to fix browser bug var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight); self.doc.height(hh); } self.lazyResize(30); self.css($(self.iframe.body), _scrollyhidden); if (cap.isios && self.haswrapper) { self.css($(doc.body), { '-webkit-transform': 'translate3d(0,0,0)' }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/ } if ('contentWindow' in this) { self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor } else { self.bind(doc, "scroll", self.onscroll); } if (opt.enablemousewheel) { self.mousewheel(doc, self.onmousewheel); } if (opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress); if (cap.cantouch) { self.bind(doc, "touchstart", self.ontouchstart); self.bind(doc, "touchmove", self.ontouchmove); } else if (opt.emulatetouch) { self.bind(doc, "mousedown", self.ontouchstart); self.bind(doc, "mousemove", function (e) { return self.ontouchmove(e, true); }); if (opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), { 'cursor': cap.cursorgrabvalue }); } self.bind(doc, "mouseup", self.ontouchend); if (self.zoom) { if (opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom); if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom); } }; if (this.doc[0].readyState && this.doc[0].readyState === "complete") { setTimeout(function () { oniframeload.call(self.doc[0], false); }, 500); } self.bind(this.doc, "load", oniframeload); } }; this.showCursor = function (py, px) { if (self.cursortimeout) { clearTimeout(self.cursortimeout); self.cursortimeout = 0; } if (!self.rail) return; if (self.autohidedom) { self.autohidedom.stop().css({ opacity: opt.cursoropacitymax }); self.cursoractive = true; } if (!self.rail.drag || self.rail.drag.pt != 1) { if (py !== undefined && py !== false) { self.scroll.y = (py / self.scrollratio.y) | 0; } if (px !== undefined) { self.scroll.x = (px / self.scrollratio.x) | 0; } } self.cursor.css({ height: self.cursorheight, top: self.scroll.y }); if (self.cursorh) { var lx = (self.hasreversehr) ? self.scrollvaluemaxw - self.scroll.x : self.scroll.x; self.cursorh.css({ width: self.cursorwidth, left: (!self.rail.align && self.rail.visibility) ? lx + self.rail.width : lx }); self.cursoractive = true; } if (self.zoom) self.zoom.stop().css({ opacity: opt.cursoropacitymax }); }; this.hideCursor = function (tm) { if (self.cursortimeout) return; if (!self.rail) return; if (!self.autohidedom) return; if (self.hasmousefocus && opt.autohidemode === "leave") return; self.cursortimeout = setTimeout(function () { if (!self.rail.active || !self.showonmouseevent) { self.autohidedom.stop().animate({ opacity: opt.cursoropacitymin }); if (self.zoom) self.zoom.stop().animate({ opacity: opt.cursoropacitymin }); self.cursoractive = false; } self.cursortimeout = 0; }, tm || opt.hidecursordelay); }; this.noticeCursor = function (tm, py, px) { self.showCursor(py, px); if (!self.rail.active) self.hideCursor(tm); }; this.getContentSize = (self.ispage) ? function () { return { w: Math.max(_doc.body.scrollWidth, _doc.documentElement.scrollWidth), h: Math.max(_doc.body.scrollHeight, _doc.documentElement.scrollHeight) }; } : (self.haswrapper) ? function () { return { w: self.doc[0].offsetWidth, h: self.doc[0].offsetHeight }; } : function () { return { w: self.docscroll[0].scrollWidth, h: self.docscroll[0].scrollHeight }; }; this.onResize = function (e, page) { if (!self || !self.win) return false; var premaxh = self.page.maxh, premaxw = self.page.maxw, previewh = self.view.h, previeww = self.view.w; self.view = { w: (self.ispage) ? self.win.width() : self.win[0].clientWidth, h: (self.ispage) ? self.win.height() : self.win[0].clientHeight }; self.page = (page) ? page : self.getContentSize(); self.page.maxh = Math.max(0, self.page.h - self.view.h); self.page.maxw = Math.max(0, self.page.w - self.view.w); if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == previeww) && (self.view.h == previewh)) { // test position if (!self.ispage) { var pos = self.win.offset(); if (self.lastposition) { var lst = self.lastposition; if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do } self.lastposition = pos; } else { return self; //nothing to do } } if (self.page.maxh === 0) { self.hideRail(); self.scrollvaluemax = 0; self.scroll.y = 0; self.scrollratio.y = 0; self.cursorheight = 0; self.setScrollTop(0); if (self.rail) self.rail.scrollable = false; } else { self.page.maxh -= (opt.railpadding.top + opt.railpadding.bottom); self.rail.scrollable = true; } if (self.page.maxw === 0) { self.hideRailHr(); self.scrollvaluemaxw = 0; self.scroll.x = 0; self.scrollratio.x = 0; self.cursorwidth = 0; self.setScrollLeft(0); if (self.railh) { self.railh.scrollable = false; } } else { self.page.maxw -= (opt.railpadding.left + opt.railpadding.right); if (self.railh) self.railh.scrollable = (opt.horizrailenabled); } self.railslocked = (self.locked) || ((self.page.maxh === 0) && (self.page.maxw === 0)); if (self.railslocked) { if (!self.ispage) self.updateScrollBar(self.view); return false; } if (!self.hidden) { if (!self.rail.visibility) self.showRail(); if (self.railh && !self.railh.visibility) self.showRailHr(); } if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20; self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h))); self.cursorheight = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorheight); self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w))); self.cursorwidth = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorwidth); self.scrollvaluemax = self.view.h - self.cursorheight - (opt.railpadding.top + opt.railpadding.bottom); if (!self.hasborderbox) self.scrollvaluemax -= self.cursor[0].offsetHeight - self.cursor[0].clientHeight; if (self.railh) { self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w; self.scrollvaluemaxw = self.railh.width - self.cursorwidth - (opt.railpadding.left + opt.railpadding.right); } if (!self.ispage) self.updateScrollBar(self.view); self.scrollratio = { x: (self.page.maxw / self.scrollvaluemaxw), y: (self.page.maxh / self.scrollvaluemax) }; var sy = self.getScrollTop(); if (sy > self.page.maxh) { self.doScrollTop(self.page.maxh); } else { self.scroll.y = (self.getScrollTop() / self.scrollratio.y) | 0; self.scroll.x = (self.getScrollLeft() / self.scrollratio.x) | 0; if (self.cursoractive) self.noticeCursor(); } if (self.scroll.y && (self.getScrollTop() === 0)) self.doScrollTo((self.scroll.y * self.scrollratio.y)|0); return self; }; this.resize = self.onResize; var hlazyresize = 0; this.onscreenresize = function(e) { clearTimeout(hlazyresize); var hiderails = (!self.ispage && !self.haswrapper); if (hiderails) self.hideRails(); hlazyresize = setTimeout(function () { if (self) { if (hiderails) self.showRails(); self.resize(); } hlazyresize=0; }, 120); }; this.lazyResize = function (tm) { // event debounce clearTimeout(hlazyresize); tm = isNaN(tm) ? 240 : tm; hlazyresize = setTimeout(function () { self && self.resize(); hlazyresize=0; }, tm); return self; }; // derived by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel function _modernWheelEvent(dom, name, fn, bubble) { self._bind(dom, name, function (e) { e = e || _win.event; var event = { original: e, target: e.target || e.srcElement, type: "wheel", deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1, deltaX: 0, deltaZ: 0, preventDefault: function () { e.preventDefault ? e.preventDefault() : e.returnValue = false; return false; }, stopImmediatePropagation: function () { (e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true; } }; if (name == "mousewheel") { e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX); e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY); !event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta); } else { event.deltaY = e.detail; } return fn.call(dom, event); }, bubble); } this.jqbind = function (dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave) self.events.push({ e: dom, n: name, f: fn, q: true }); $(dom).on(name, fn); }; this.mousewheel = function (dom, fn, bubble) { // bind mousewheel var el = ("jquery" in dom) ? dom[0] : dom; if ("onwheel" in _doc.createElement("div")) { // Modern browsers support "wheel" self._bind(el, "wheel", fn, bubble || false); } else { var wname = (_doc.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox _modernWheelEvent(el, wname, fn, bubble || false); if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy } }; var passiveSupported = false; if (cap.haseventlistener) { // W3C standard event model // thanks to https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener try { var options = Object.defineProperty({}, "passive", { get: function () { passiveSupported = !0; } }); _win.addEventListener("test", null, options); } catch (err) { } this.stopPropagation = function (e) { if (!e) return false; e = (e.original) ? e.original : e; e.stopPropagation(); return false; }; this.cancelEvent = function(e) { if (e.cancelable) e.preventDefault(); e.stopImmediatePropagation(); if (e.preventManipulation) e.preventManipulation(); // IE10+ return false; }; } else { // inspired from https://gist.github.com/jonathantneal/2415137 Event.prototype.preventDefault = function () { this.returnValue = false; }; Event.prototype.stopPropagation = function () { this.cancelBubble = true; }; _win.constructor.prototype.addEventListener = _doc.constructor.prototype.addEventListener = Element.prototype.addEventListener = function (type, listener, useCapture) { this.attachEvent("on" + type, listener); }; _win.constructor.prototype.removeEventListener = _doc.constructor.prototype.removeEventListener = Element.prototype.removeEventListener = function (type, listener, useCapture) { this.detachEvent("on" + type, listener); }; // Thanks to http://www.switchonthecode.com !! this.cancelEvent = function (e) { e = e || _win.event; if (e) { e.cancelBubble = true; e.cancel = true; e.returnValue = false; } return false; }; this.stopPropagation = function (e) { e = e || _win.event; if (e) e.cancelBubble = true; return false; }; } this.delegate = function (dom, name, fn, bubble, active) { var de = delegatevents[name] || false; if (!de) { de = { a: [], l: [], f: function (e) { var lst = de.l, l = lst.length - 1; var r = false; for (var a = l; a >= 0; a--) { r = lst[a].call(e.target, e); if (r === false) return false; } return r; } }; self.bind(dom, name, de.f, bubble, active); delegatevents[name] = de; } if (self.ispage) { de.a = [self.id].concat(de.a); de.l = [fn].concat(de.l); } else { de.a.push(self.id); de.l.push(fn); } }; this.undelegate = function (dom, name, fn, bubble, active) { var de = delegatevents[name]||false; if (de&&de.l) { // quick fix #683 for (var a=0,l=de.l.length;a<l;a++) { if (de.a[a] === self.id) { de.a.splice(a); de.l.splice(a); if (de.a.length===0) { self._unbind(dom,name,de.l.f); delegatevents[name] = null; } } } } }; this.bind = function (dom, name, fn, bubble, active) { var el = ("jquery" in dom) ? dom[0] : dom; self._bind(el, name, fn, bubble || false, active || false); }; this._bind = function (el, name, fn, bubble, active) { // primitive bind self.events.push({ e: el, n: name, f: fn, b: bubble, q: false }); (passiveSupported && active) ? el.addEventListener(name, fn, { passive: false, capture: bubble }) : el.addEventListener(name, fn, bubble || false); }; this._unbind = function (el, name, fn, bub) { // primitive unbind if (delegatevents[name]) self.undelegate(el, name, fn, bub); else el.removeEventListener(name, fn, bub); }; this.unbindAll = function () { for (var a = 0; a < self.events.length; a++) { var r = self.events[a]; (r.q) ? r.e.unbind(r.n, r.f) : self._unbind(r.e, r.n, r.f, r.b); } }; this.showRails = function () { return self.showRail().showRailHr(); }; this.showRail = function () { if ((self.page.maxh !== 0) && (self.ispage || self.win.css('display') != 'none')) { //self.visibility = true; self.rail.visibility = true; self.rail.css('display', 'block'); } return self; }; this.showRailHr = function () { if (self.railh) { if ((self.page.maxw !== 0) && (self.ispage || self.win.css('display') != 'none')) { self.railh.visibility = true; self.railh.css('display', 'block'); } } return self; }; this.hideRails = function () { return self.hideRail().hideRailHr(); }; this.hideRail = function () { //self.visibility = false; self.rail.visibility = false; self.rail.css('display', 'none'); return self; }; this.hideRailHr = function () { if (self.railh) { self.railh.visibility = false; self.railh.css('display', 'none'); } return self; }; this.show = function () { self.hidden = false; self.railslocked = false; return self.showRails(); }; this.hide = function () { self.hidden = true; self.railslocked = true; return self.hideRails(); }; this.toggle = function () { return (self.hidden) ? self.show() : self.hide(); }; this.remove = function () { self.stop(); if (self.cursortimeout) clearTimeout(self.cursortimeout); for (var n in self.delaylist) if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h); self.doZoomOut(); self.unbindAll(); if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug if (self.observer !== false) self.observer.disconnect(); if (self.observerremover !== false) self.observerremover.disconnect(); if (self.observerbody !== false) self.observerbody.disconnect(); self.events = null; if (self.cursor) { self.cursor.remove(); } if (self.cursorh) { self.cursorh.remove(); } if (self.rail) { self.rail.remove(); } if (self.railh) { self.railh.remove(); } if (self.zoom) { self.zoom.remove(); } for (var a = 0; a < self.saved.css.length; a++) { var d = self.saved.css[a]; d[0].css(d[1], (d[2] === undefined) ? '' : d[2]); } self.saved = false; self.me.data('__nicescroll', ''); //erase all traces // memory leak fixed by GianlucaGuarini - thanks a lot! // remove the current nicescroll from the $.nicescroll array & normalize array var lst = $.nicescroll; lst.each(function (i) { if (!this) return; if (this.id === self.id) { delete lst[i]; for (var b = ++i; b < lst.length; b++ , i++) lst[i] = lst[b]; lst.length--; if (lst.length) delete lst[lst.length]; } }); for (var i in self) { self[i] = null; delete self[i]; } self = null; }; this.scrollstart = function (fn) { this.onscrollstart = fn; return self; }; this.scrollend = function (fn) { this.onscrollend = fn; return self; }; this.scrollcancel = function (fn) { this.onscrollcancel = fn; return self; }; this.zoomin = function (fn) { this.onzoomin = fn; return self; }; this.zoomout = function (fn) { this.onzoomout = fn; return self; }; this.isScrollable = function (e) { var dom = (e.target) ? e.target : e; if (dom.nodeName == 'OPTION') return true; while (dom && (dom.nodeType == 1) && (dom !== this.me[0]) && !(/^BODY|HTML/.test(dom.nodeName))) { var dd = $(dom); var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || ''; if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight); dom = (dom.parentNode) ? dom.parentNode : false; } return false; }; this.getViewport = function (me) { var dom = (me && me.parentNode) ? me.parentNode : false; while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) { var dd = $(dom); if (/fixed|absolute/.test(dd.css("position"))) return dd; var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || ''; if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd; if (dd.getNiceScroll().length > 0) return dd; dom = (dom.parentNode) ? dom.parentNode : false; } return false; }; this.triggerScrollStart = function (cx, cy, rx, ry, ms) { if (self.onscrollstart) { var info = { type: "scrollstart", current: { x: cx, y: cy }, request: { x: rx, y: ry }, end: { x: self.newscrollx, y: self.newscrolly }, speed: ms }; self.onscrollstart.call(self, info); } }; this.triggerScrollEnd = function () { if (self.onscrollend) { var px = self.getScrollLeft(); var py = self.getScrollTop(); var info = { type: "scrollend", current: { x: px, y: py }, end: { x: px, y: py } }; self.onscrollend.call(self, info); } }; var scrolldiry = 0, scrolldirx = 0, scrolltmr = 0, scrollspd = 1; function doScrollRelative(px, py, chkscroll, iswheel) { if (!self.scrollrunning) { self.newscrolly = self.getScrollTop(); self.newscrollx = self.getScrollLeft(); scrolltmr = now(); } var gap = (now() - scrolltmr); scrolltmr = now(); if (gap > 350) { scrollspd = 1; } else { scrollspd += (2 - scrollspd) / 10; } px = px * scrollspd | 0; py = py * scrollspd | 0; if (px) { if (iswheel) { // mouse-only if (px < 0) { // fix apple magic mouse swipe back/forward if (self.getScrollLeft() >= self.page.maxw) return true; } else { if (self.getScrollLeft() <= 0) return true; } } var dx = px > 0 ? 1 : -1; if (scrolldirx !== dx) { if (self.scrollmom) self.scrollmom.stop(); self.newscrollx = self.getScrollLeft(); scrolldirx = dx; } self.lastdeltax -= px; } if (py) { var chk = (function () { var top = self.getScrollTop(); if (py < 0) { if (top >= self.page.maxh) return true; } else { if (top <= 0) return true; } })(); if (chk) { if (opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) return true; var ny = self.view.h >> 1; if (self.newscrolly < -ny) { self.newscrolly = -ny; py = -1; } else if (self.newscrolly > self.page.maxh + ny) { self.newscrolly = self.page.maxh + ny; py = 1; } else py = 0; } var dy = py > 0 ? 1 : -1; if (scrolldiry !== dy) { if (self.scrollmom) self.scrollmom.stop(); self.newscrolly = self.getScrollTop(); scrolldiry = dy; } self.lastdeltay -= py; } if (py || px) { self.synched("relativexy", function () { var dty = self.lastdeltay + self.newscrolly; self.lastdeltay = 0; var dtx = self.lastdeltax + self.newscrollx; self.lastdeltax = 0; if (!self.rail.drag) self.doScrollPos(dtx, dty); }); } } var hasparentscrollingphase = false; function execScrollWheel(e, hr, chkscroll) { var px, py; if (!chkscroll && hasparentscrollingphase) return true; if (e.deltaMode === 0) { // PIXEL px = -(e.deltaX * (opt.mousescrollstep / (18 * 3))) | 0; py = -(e.deltaY * (opt.mousescrollstep / (18 * 3))) | 0; } else if (e.deltaMode === 1) { // LINE px = -(e.deltaX * opt.mousescrollstep * 50 / 80) | 0; py = -(e.deltaY * opt.mousescrollstep * 50 / 80) | 0; } if (hr && opt.oneaxismousemode && (px === 0) && py) { // classic vertical-only mousewheel + browser with x/y support px = py; py = 0; if (chkscroll) { var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0); if (hrend) { // preserve vertical scrolling py = px; px = 0; } } } // invert horizontal direction for rtl mode if (self.isrtlmode) px = -px; var chk = doScrollRelative(px, py, chkscroll, true); if (chk) { if (chkscroll) hasparentscrollingphase = true; } else { hasparentscrollingphase = false; e.stopImmediatePropagation(); return e.preventDefault(); } } this.onmousewheel = function (e) { if (self.wheelprevented||self.locked) return false; if (self.railslocked) { self.debounced("checkunlock", self.resize, 250); return false; } if (self.rail.drag) return self.cancelEvent(e); if (opt.oneaxismousemode === "auto" && e.deltaX !== 0) opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant) if (opt.oneaxismousemode && e.deltaX === 0) { if (!self.rail.scrollable) { if (self.railh && self.railh.scrollable) { return self.onmousewheelhr(e); } else { return true; } } } var nw = now(); var chk = false; if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) { self.nativescrollingarea = self.isScrollable(e); chk = true; } self.checkarea = nw; if (self.nativescrollingarea) return true; // this isn't my business var ret = execScrollWheel(e, false, chk); if (ret) self.checkarea = 0; return ret; }; this.onmousewheelhr = function (e) { if (self.wheelprevented) return; if (self.railslocked || !self.railh.scrollable) return true; if (self.rail.drag) return self.cancelEvent(e); var nw = now(); var chk = false; if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) { self.nativescrollingarea = self.isScrollable(e); chk = true; } self.checkarea = nw; if (self.nativescrollingarea) return true; // this is not my business if (self.railslocked) return self.cancelEvent(e); return execScrollWheel(e, true, chk); }; this.stop = function () { self.cancelScroll(); if (self.scrollmon) self.scrollmon.stop(); self.cursorfreezed = false; self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y)); self.noticeCursor(); return self; }; this.getTransitionSpeed = function (dif) { return 80 + (dif / 72) * opt.scrollspeed |0; }; if (!opt.smoothscroll) { this.doScrollLeft = function (x, spd) { //direct var y = self.getScrollTop(); self.doScrollPos(x, y, spd); }; this.doScrollTop = function (y, spd) { //direct var x = self.getScrollLeft(); self.doScrollPos(x, y, spd); }; this.doScrollPos = function (x, y, spd) { //direct var nx = (x > self.page.maxw) ? self.page.maxw : x; if (nx < 0) nx = 0; var ny = (y > self.page.maxh) ? self.page.maxh : y; if (ny < 0) ny = 0; self.synched('scroll', function () { self.setScrollTop(ny); self.setScrollLeft(nx); }); }; this.cancelScroll = function () { }; // direct } else if (self.ishwscroll && cap.hastransition && opt.usetransition && !!opt.smoothscroll) { var lasttransitionstyle = ''; this.resetTransition = function () { lasttransitionstyle = ''; self.doc.css(cap.prefixstyle + 'transition-duration', '0ms'); }; this.prepareTransition = function (dif, istime) { var ex = (istime) ? dif : self.getTransitionSpeed(dif); var trans = ex + 'ms'; if (lasttransitionstyle !== trans) { lasttransitionstyle = trans; self.doc.css(cap.prefixstyle + 'transition-duration', trans); } return ex; }; this.doScrollLeft = function (x, spd) { //trans var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); self.doScrollPos(x, y, spd); }; this.doScrollTop = function (y, spd) { //trans var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); self.doScrollPos(x, y, spd); }; this.cursorupdate = { running: false, start: function () { var m = this; if (m.running) return; m.running = true; var loop = function () { if (m.running) setAnimationFrame(loop); self.showCursor(self.getScrollTop(), self.getScrollLeft()); self.notifyScrollEvent(self.win[0]); }; setAnimationFrame(loop); }, stop: function () { this.running = false; } }; this.doScrollPos = function (x, y, spd) { //trans var py = self.getScrollTop(); var px = self.getScrollLeft(); if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection if (!opt.bouncescroll) { if (y < 0) y = 0; else if (y > self.page.maxh) y = self.page.maxh; if (x < 0) x = 0; else if (x > self.page.maxw) x = self.page.maxw; } else { if (y < 0) y = y / 2 | 0; else if (y > self.page.maxh) y = self.page.maxh + (y - self.page.maxh) / 2 | 0; if (x < 0) x = x / 2 | 0; else if (x > self.page.maxw) x = self.page.maxw + (x - self.page.maxw) / 2 | 0; } if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false; self.newscrolly = y; self.newscrollx = x; var top = self.getScrollTop(); var lft = self.getScrollLeft(); var dst = {}; dst.x = x - lft; dst.y = y - top; var dd = Math.sqrt((dst.x * dst.x) + (dst.y * dst.y)) | 0; var ms = self.prepareTransition(dd); if (!self.scrollrunning) { self.scrollrunning = true; self.triggerScrollStart(lft, top, x, y, ms); self.cursorupdate.start(); } self.scrollendtrapped = true; if (!cap.transitionend) { if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped); self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event } self.setScrollTop(self.newscrolly); self.setScrollLeft(self.newscrollx); }; this.cancelScroll = function () { if (!self.scrollendtrapped) return true; var py = self.getScrollTop(); var px = self.getScrollLeft(); self.scrollrunning = false; if (!cap.transitionend) clearTimeout(cap.transitionend); self.scrollendtrapped = false; self.resetTransition(); self.setScrollTop(py); // fire event onscroll if (self.railh) self.setScrollLeft(px); if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm); self.timerscroll = false; self.cursorfreezed = false; self.cursorupdate.stop(); self.showCursor(py, px); return self; }; this.onScrollTransitionEnd = function () { if (!self.scrollendtrapped) return; var py = self.getScrollTop(); var px = self.getScrollLeft(); if (py < 0) py = 0; else if (py > self.page.maxh) py = self.page.maxh; if (px < 0) px = 0; else if (px > self.page.maxw) px = self.page.maxw; if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, opt.snapbackspeed); if (self.scrollrunning) self.triggerScrollEnd(); self.scrollrunning = false; self.scrollendtrapped = false; self.resetTransition(); self.timerscroll = false; self.setScrollTop(py); // fire event onscroll if (self.railh) self.setScrollLeft(px); // fire event onscroll left self.cursorupdate.stop(); self.noticeCursor(false, py, px); self.cursorfreezed = false; }; } else { this.doScrollLeft = function (x, spd) { //no-trans var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); self.doScrollPos(x, y, spd); }; this.doScrollTop = function (y, spd) { //no-trans var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); self.doScrollPos(x, y, spd); }; this.doScrollPos = function (x, y, spd) { //no-trans var py = self.getScrollTop(); var px = self.getScrollLeft(); if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection var clipped = false; if (!self.bouncescroll || !self.rail.visibility) { if (y < 0) { y = 0; clipped = true; } else if (y > self.page.maxh) { y = self.page.maxh; clipped = true; } } if (!self.bouncescroll || !self.railh.visibility) { if (x < 0) { x = 0; clipped = true; } else if (x > self.page.maxw) { x = self.page.maxw; clipped = true; } } if (self.scrollrunning && (self.newscrolly === y) && (self.newscrollx === x)) return true; self.newscrolly = y; self.newscrollx = x; self.dst = {}; self.dst.x = x - px; self.dst.y = y - py; self.dst.px = px; self.dst.py = py; var dd = Math.sqrt((self.dst.x * self.dst.x) + (self.dst.y * self.dst.y)) | 0; var ms = self.getTransitionSpeed(dd); self.bzscroll = {}; var p3 = (clipped) ? 1 : 0.58; self.bzscroll.x = new BezierClass(px, self.newscrollx, ms, 0, 0, p3, 1); self.bzscroll.y = new BezierClass(py, self.newscrolly, ms, 0, 0, p3, 1); var loopid = now(); var loop = function () { if (!self.scrollrunning) return; var x = self.bzscroll.y.getPos(); self.setScrollLeft(self.bzscroll.x.getNow()); self.setScrollTop(self.bzscroll.y.getNow()); if (x <= 1) { self.timer = setAnimationFrame(loop); } else { self.scrollrunning = false; self.timer = 0; self.triggerScrollEnd(); } }; if (!self.scrollrunning) { self.triggerScrollStart(px, py, x, y, ms); self.scrollrunning = true; self.timer = setAnimationFrame(loop); } }; this.cancelScroll = function () { if (self.timer) clearAnimationFrame(self.timer); self.timer = 0; self.bzscroll = false; self.scrollrunning = false; return self; }; } this.doScrollBy = function (stp, relative) { doScrollRelative(0, stp); }; this.doScrollLeftBy = function (stp, relative) { doScrollRelative(stp, 0); }; this.doScrollTo = function (pos, relative) { var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos; if (ny < 0) ny = 0; else if (ny > self.page.maxh) ny = self.page.maxh; self.cursorfreezed = false; self.doScrollTop(pos); }; this.checkContentSize = function () { var pg = self.getContentSize(); if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg); }; self.onscroll = function (e) { if (self.rail.drag) return; if (!self.cursorfreezed) { self.synched('scroll', function () { self.scroll.y = Math.round(self.getScrollTop() / self.scrollratio.y); if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() / self.scrollratio.x); self.noticeCursor(); }); } }; self.bind(self.docscroll, "scroll", self.onscroll); this.doZoomIn = function (e) { if (self.zoomactive) return; self.zoomactive = true; self.zoomrestore = { style: {} }; var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight']; var win = self.win[0].style; for (var a in lst) { var pp = lst[a]; self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : ''; } self.zoomrestore.style.width = self.win.css('width'); self.zoomrestore.style.height = self.win.css('height'); self.zoomrestore.padding = { w: self.win.outerWidth() - self.win.width(), h: self.win.outerHeight() - self.win.height() }; if (cap.isios4) { self.zoomrestore.scrollTop = $window.scrollTop(); $window.scrollTop(0); } self.win.css({ position: (cap.isios4) ? "absolute" : "fixed", top: 0, left: 0, zIndex: globalmaxzindex + 100, margin: 0 }); var bkg = self.win.css("backgroundColor"); if ("" === bkg || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff"); self.rail.css({ zIndex: globalmaxzindex + 101 }); self.zoom.css({ zIndex: globalmaxzindex + 102 }); self.zoom.css('backgroundPosition', '0 -18px'); self.resizeZoom(); if (self.onzoomin) self.onzoomin.call(self); return self.cancelEvent(e); }; this.doZoomOut = function (e) { if (!self.zoomactive) return; self.zoomactive = false; self.win.css("margin", ""); self.win.css(self.zoomrestore.style); if (cap.isios4) { $window.scrollTop(self.zoomrestore.scrollTop); } self.rail.css({ "z-index": self.zindex }); self.zoom.css({ "z-index": self.zindex }); self.zoomrestore = false; self.zoom.css('backgroundPosition', '0 0'); self.onResize(); if (self.onzoomout) self.onzoomout.call(self); return self.cancelEvent(e); }; this.doZoom = function (e) { return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e); }; this.resizeZoom = function () { if (!self.zoomactive) return; var py = self.getScrollTop(); //preserve scrolling position self.win.css({ width: $window.width() - self.zoomrestore.padding.w + "px", height: $window.height() - self.zoomrestore.padding.h + "px" }); self.onResize(); self.setScrollTop(Math.min(self.page.maxh, py)); }; this.init(); $.nicescroll.push(this); }; // Inspired by the work of Kin Blas // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js var ScrollMomentumClass2D = function (nc) { var self = this; this.nc = nc; this.lastx = 0; this.lasty = 0; this.speedx = 0; this.speedy = 0; this.lasttime = 0; this.steptime = 0; this.snapx = false; this.snapy = false; this.demulx = 0; this.demuly = 0; this.lastscrollx = -1; this.lastscrolly = -1; this.chkx = 0; this.chky = 0; this.timer = 0; this.reset = function (px, py) { self.stop(); self.steptime = 0; self.lasttime = now(); self.speedx = 0; self.speedy = 0; self.lastx = px; self.lasty = py; self.lastscrollx = -1; self.lastscrolly = -1; }; this.update = function (px, py) { var tm = now(); self.steptime = tm - self.lasttime; self.lasttime = tm; var dy = py - self.lasty; var dx = px - self.lastx; var sy = self.nc.getScrollTop(); var sx = self.nc.getScrollLeft(); var newy = sy + dy; var newx = sx + dx; self.snapx = (newx < 0) || (newx > self.nc.page.maxw); self.snapy = (newy < 0) || (newy > self.nc.page.maxh); self.speedx = dx; self.speedy = dy; self.lastx = px; self.lasty = py; }; this.stop = function () { self.nc.unsynched("domomentum2d"); if (self.timer) clearTimeout(self.timer); self.timer = 0; self.lastscrollx = -1; self.lastscrolly = -1; }; this.doSnapy = function (nx, ny) { var snap = false; if (ny < 0) { ny = 0; snap = true; } else if (ny > self.nc.page.maxh) { ny = self.nc.page.maxh; snap = true; } if (nx < 0) { nx = 0; snap = true; } else if (nx > self.nc.page.maxw) { nx = self.nc.page.maxw; snap = true; } (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed) : self.nc.triggerScrollEnd(); }; this.doMomentum = function (gp) { var t = now(); var l = (gp) ? t + gp : self.lasttime; var sl = self.nc.getScrollLeft(); var st = self.nc.getScrollTop(); var pageh = self.nc.page.maxh; var pagew = self.nc.page.maxw; self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0; self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0; var chk = l && (t - l) <= 60; if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false; var sy = (self.speedy && chk) ? self.speedy : false; var sx = (self.speedx && chk) ? self.speedx : false; if (sy || sx) { var tm = Math.max(16, self.steptime); //timeout granularity if (tm > 50) { // do smooth var xm = tm / 50; self.speedx *= xm; self.speedy *= xm; tm = 50; } self.demulxy = 0; self.lastscrollx = self.nc.getScrollLeft(); self.chkx = self.lastscrollx; self.lastscrolly = self.nc.getScrollTop(); self.chky = self.lastscrolly; var nx = self.lastscrollx; var ny = self.lastscrolly; var onscroll = function () { var df = ((now() - t) > 600) ? 0.04 : 0.02; if (self.speedx) { nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy))); self.lastscrollx = nx; if ((nx < 0) || (nx > pagew)) df = 0.10; } if (self.speedy) { ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy))); self.lastscrolly = ny; if ((ny < 0) || (ny > pageh)) df = 0.10; } self.demulxy = Math.min(1, self.demulxy + df); self.nc.synched("domomentum2d", function () { if (self.speedx) { var scx = self.nc.getScrollLeft(); // if (scx != self.chkx) self.stop(); self.chkx = nx; self.nc.setScrollLeft(nx); } if (self.speedy) { var scy = self.nc.getScrollTop(); // if (scy != self.chky) self.stop(); self.chky = ny; self.nc.setScrollTop(ny); } if (!self.timer) { self.nc.hideCursor(); self.doSnapy(nx, ny); } }); if (self.demulxy < 1) { self.timer = setTimeout(onscroll, tm); } else { self.stop(); self.nc.hideCursor(); self.doSnapy(nx, ny); } }; onscroll(); } else { self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop()); } }; }; // override jQuery scrollTop var _scrollTop = jQuery.fn.scrollTop; // preserve original function jQuery.cssHooks.pageYOffset = { get: function (elem, computed, extra) { var nice = $.data(elem, '__nicescroll') || false; return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem); }, set: function (elem, value) { var nice = $.data(elem, '__nicescroll') || false; (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem, value); return this; } }; jQuery.fn.scrollTop = function (value) { if (value === undefined) { var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false; return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this); } else { return this.each(function () { var nice = $.data(this, '__nicescroll') || false; (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this), value); }); } }; // override jQuery scrollLeft var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function $.cssHooks.pageXOffset = { get: function (elem, computed, extra) { var nice = $.data(elem, '__nicescroll') || false; return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem); }, set: function (elem, value) { var nice = $.data(elem, '__nicescroll') || false; (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem, value); return this; } }; jQuery.fn.scrollLeft = function (value) { if (value === undefined) { var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false; return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this); } else { return this.each(function () { var nice = $.data(this, '__nicescroll') || false; (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this), value); }); } }; var NiceScrollArray = function (doms) { var self = this; this.length = 0; this.name = "nicescrollarray"; this.each = function (fn) { $.each(self, fn); return self; }; this.push = function (nice) { self[self.length] = nice; self.length++; }; this.eq = function (idx) { return self[idx]; }; if (doms) { for (var a = 0; a < doms.length; a++) { var nice = $.data(doms[a], '__nicescroll') || false; if (nice) { this[this.length] = nice; this.length++; } } } return this; }; function mplex(el, lst, fn) { for (var a = 0, l = lst.length; a < l; a++) fn(el, lst[a]); } mplex( NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'], function (e, n) { e[n] = function () { var args = arguments; return this.each(function () { this[n].apply(this, args); }); }; } ); jQuery.fn.getNiceScroll = function (index) { if (index === undefined) { return new NiceScrollArray(this); } else { return this[index] && $.data(this[index], '__nicescroll') || false; } }; var pseudos = jQuery.expr.pseudos || jQuery.expr[':']; // jQuery 3 migration pseudos.nicescroll = function (a) { return $.data(a, '__nicescroll') !== undefined; }; $.fn.niceScroll = function (wrapper, _opt) { if (_opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) { _opt = wrapper; wrapper = false; } var ret = new NiceScrollArray(); this.each(function () { var $this = $(this); var opt = $.extend({}, _opt); // cloning if (wrapper || false) { var wrp = $(wrapper); opt.doc = (wrp.length > 1) ? $(wrapper, $this) : wrp; opt.win = $this; } var docundef = !("doc" in opt); if (!docundef && !("win" in opt)) opt.win = $this; var nice = $this.data('__nicescroll') || false; if (!nice) { opt.doc = opt.doc || $this; nice = new NiceScrollClass(opt, $this); $this.data('__nicescroll', nice); } ret.push(nice); }); return (ret.length === 1) ? ret[0] : ret; }; _win.NiceScroll = { getjQuery: function () { return jQuery; } }; if (!$.nicescroll) { $.nicescroll = new NiceScrollArray(); $.nicescroll.options = _globaloptions; } }));